C16H10F12 — CID 588499
1,3,6,8,11,11,12,12,13,13,14,14-dodecafluoro-4,5-dimethyltetracyclo[6.2.2.23,6.02,7]tetradeca-4,9-diene (PubChem CID 588499) has the molecular formula C16H10F12 and a molecular weight of 430.23 g/mol. Its IUPAC name is 1,3,6,8,11,11,12,12,13,13,14,14-dodecafluoro-4,5-dimethyltetracyclo[6.2.2.23,6.02,7]tetradeca-4,9-diene.
| Compound Name | 1,3,6,8,11,11,12,12,13,13,14,14-dodecafluoro-4,5-dimethyltetracyclo[6.2.2.23,6.02,7]tetradeca-4,9-diene |
|---|---|
| PubChem CID | 588499 |
| Molecular Formula | C16H10F12 |
| Molecular Weight | 430.23 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | 1,3,6,8,11,11,12,12,13,13,14,14-dodecafluoro-4,5-dimethyltetracyclo[6.2.2.23,6.02,7]tetradeca-4,9-diene |
| SMILES | CC1=C(C)C2(F)C3C(C4(F)C=CC3(F)C(F)(F)C4(F)F)C1(F)C(F)(F)C2(F)F |
| InChI | InChI=1S/C16H10F12/c1-5-6(2)12(20)8-7(11(5,19)15(25,26)16(12,27)28)9(17)3-4-10(8,18)14(23,24)13(9,21)22/h3-4,7-8H,1-2H3 |
| InChIKey | RWCUUBOBTSAJMA-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.23 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|