C10H17N3O2 — CID 58849993
3-acetyl-6-(methylamino)-2,3,6,7,8,8a-hexahydro-1H-imidazo[1,2-a]pyridin-5-one (PubChem CID 58849993) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is 3-acetyl-6-(methylamino)-2,3,6,7,8,8a-hexahydro-1H-imidazo[1,2-a]pyridin-5-one.
| Compound Name | 3-acetyl-6-(methylamino)-2,3,6,7,8,8a-hexahydro-1H-imidazo[1,2-a]pyridin-5-one |
|---|---|
| PubChem CID | 58849993 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 3-acetyl-6-(methylamino)-2,3,6,7,8,8a-hexahydro-1H-imidazo[1,2-a]pyridin-5-one |
| SMILES | CNC1CCC2NCC(C(C)=O)N2C1=O |
| InChI | InChI=1S/C10H17N3O2/c1-6(14)8-5-12-9-4-3-7(11-2)10(15)13(8)9/h7-9,11-12H,3-5H2,1-2H3 |
| InChIKey | OOJICTWECJUNRP-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |