About (2S)-1,2-ditert-butyl-4,4-difluoropyrrolidine
(2S)-1,2-ditert-butyl-4,4-difluoropyrrolidine (PubChem CID 58850020) has the molecular formula C12H23F2N
and a molecular weight of 219.32 g/mol. Its IUPAC name is (2S)-1,2-ditert-butyl-4,4-difluoropyrrolidine.
Molecular Properties
| Compound Name | (2S)-1,2-ditert-butyl-4,4-difluoropyrrolidine |
| PubChem CID | 58850020 |
| Molecular Formula | C12H23F2N |
| Molecular Weight | 219.32 g/mol |
| Exact Mass | 219.18 |
| IUPAC Name | (2S)-1,2-ditert-butyl-4,4-difluoropyrrolidine |
| SMILES | CC(C)(C)[C@@H]1CC(F)(F)CN1C(C)(C)C |
| InChI | InChI=1S/C12H23F2N/c1-10(2,3)9-7-12(13,14)8-15(9)11(4,5)6/h9H,7-8H2,1-6H3/t9-/m0/s1 |
| InChIKey | RJOZFBGHZGURBC-VIFPVBQESA-N |
| XLogP | 3.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S)-1,2-ditert-butyl-4,4-difluoropyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1,2-ditert-butyl-4,4-difluoropyrrolidine?
The IUPAC name of (2S)-1,2-ditert-butyl-4,4-difluoropyrrolidine (CID 58850020) is (2S)-1,2-ditert-butyl-4,4-difluoropyrrolidine.
What is the SMILES notation for (2S)-1,2-ditert-butyl-4,4-difluoropyrrolidine?
The canonical SMILES for (2S)-1,2-ditert-butyl-4,4-difluoropyrrolidine is CC(C)(C)[C@@H]1CC(F)(F)CN1C(C)(C)C.
What is the InChIKey of (2S)-1,2-ditert-butyl-4,4-difluoropyrrolidine?
The InChIKey is RJOZFBGHZGURBC-VIFPVBQESA-N. The full InChI is InChI=1S/C12H23F2N/c1-10(2,3)9-7-12(13,14)8-15(9)11(4,5)6/h9H,7-8H2,1-6H3/t9-/m0/s1.
What are the key properties of (2S)-1,2-ditert-butyl-4,4-difluoropyrrolidine?
(2S)-1,2-ditert-butyl-4,4-difluoropyrrolidine has a molecular weight of 219.32 g/mol, XLogP of 3.54, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1,2-ditert-butyl-4,4-difluoropyrrolidine is sourced from PubChem (CID 58850020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).