About 8-butan-2-yl-2-phenyl-1,10-phenanthroline
8-butan-2-yl-2-phenyl-1,10-phenanthroline (PubChem CID 58850569) has the molecular formula C22H20N2
and a molecular weight of 312.42 g/mol. Its IUPAC name is 8-butan-2-yl-2-phenyl-1,10-phenanthroline.
Molecular Properties
| Compound Name | 8-butan-2-yl-2-phenyl-1,10-phenanthroline |
| PubChem CID | 58850569 |
| Molecular Formula | C22H20N2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 8-butan-2-yl-2-phenyl-1,10-phenanthroline |
| SMILES | CCC(C)c1cnc2c(ccc3ccc(-c4ccccc4)nc32)c1 |
| InChI | InChI=1S/C22H20N2/c1-3-15(2)19-13-18-10-9-17-11-12-20(16-7-5-4-6-8-16)24-22(17)21(18)23-14-19/h4-15H,3H2,1-2H3 |
| InChIKey | ZVGQWJDSLLECGL-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 8-butan-2-yl-2-phenyl-1,10-phenanthroline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-butan-2-yl-2-phenyl-1,10-phenanthroline?
The IUPAC name of 8-butan-2-yl-2-phenyl-1,10-phenanthroline (CID 58850569) is 8-butan-2-yl-2-phenyl-1,10-phenanthroline.
What is the SMILES notation for 8-butan-2-yl-2-phenyl-1,10-phenanthroline?
The canonical SMILES for 8-butan-2-yl-2-phenyl-1,10-phenanthroline is CCC(C)c1cnc2c(ccc3ccc(-c4ccccc4)nc32)c1.
What is the InChIKey of 8-butan-2-yl-2-phenyl-1,10-phenanthroline?
The InChIKey is ZVGQWJDSLLECGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N2/c1-3-15(2)19-13-18-10-9-17-11-12-20(16-7-5-4-6-8-16)24-22(17)21(18)23-14-19/h4-15H,3H2,1-2H3.
What are the key properties of 8-butan-2-yl-2-phenyl-1,10-phenanthroline?
8-butan-2-yl-2-phenyl-1,10-phenanthroline has a molecular weight of 312.42 g/mol, XLogP of 5.96, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-butan-2-yl-2-phenyl-1,10-phenanthroline is sourced from PubChem (CID 58850569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).