C17H25NO — CID 58850798
(1S,2S,5R)-N-benzyl-2-methyl-5-propan-2-ylcyclopentane-1-carboxamide (PubChem CID 58850798) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is (1S,2S,5R)-N-benzyl-2-methyl-5-propan-2-ylcyclopentane-1-carboxamide.
| Compound Name | (1S,2S,5R)-N-benzyl-2-methyl-5-propan-2-ylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 58850798 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | (1S,2S,5R)-N-benzyl-2-methyl-5-propan-2-ylcyclopentane-1-carboxamide |
| SMILES | CC(C)[C@H]1CC[C@H](C)[C@@H]1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C17H25NO/c1-12(2)15-10-9-13(3)16(15)17(19)18-11-14-7-5-4-6-8-14/h4-8,12-13,15-16H,9-11H2,1-3H3,(H,18,19)/t13-,15+,16-/m0/s1 |
| InChIKey | UDEGLAQJHXGEFE-IMJJTQAJSA-N |
| XLogP | 3.62 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |