C69H46N4O — CID 58850905
(2,3,6-triphenyl-4,5-dipyridin-2-ylphenyl)-(2,3,6-triphenyl-5-pyridin-2-yl-4-pyridin-3-ylphenyl)methanone (PubChem CID 58850905) has the molecular formula C69H46N4O and a molecular weight of 947.15 g/mol. Its IUPAC name is (2,3,6-triphenyl-4,5-dipyridin-2-ylphenyl)-(2,3,6-triphenyl-5-pyridin-2-yl-4-pyridin-3-ylphenyl)methanone.
| Compound Name | (2,3,6-triphenyl-4,5-dipyridin-2-ylphenyl)-(2,3,6-triphenyl-5-pyridin-2-yl-4-pyridin-3-ylphenyl)methanone |
|---|---|
| PubChem CID | 58850905 |
| Molecular Formula | C69H46N4O |
| Molecular Weight | 947.15 g/mol |
| Exact Mass | 946.37 |
| IUPAC Name | (2,3,6-triphenyl-4,5-dipyridin-2-ylphenyl)-(2,3,6-triphenyl-5-pyridin-2-yl-4-pyridin-3-ylphenyl)methanone |
| SMILES | O=C(c1c(-c2ccccc2)c(-c2ccccc2)c(-c2cccnc2)c(-c2ccccn2)c1-c1ccccc1)c1c(-c2ccccc2)c(-c2ccccc2)c(-c2ccccn2)c(-c2ccccn2)c1-c1ccccc1 |
| InChI | InChI=1S/C69H46N4O/c74-69(67-59(49-30-11-3-12-31-49)57(47-26-7-1-8-27-47)63(53-38-25-42-70-46-53)64(54-39-19-22-43-71-54)61(67)51-34-15-5-16-35-51)68-60(50-32-13-4-14-33-50)58(48-28-9-2-10-29-48)65(55-40-20-23-44-72-55)66(56-41-21-24-45-73-56)62(68)52-36-17-6-18-37-52/h1-46H |
| InChIKey | IWLVLTTUPRZBBN-UHFFFAOYSA-N |
| XLogP | 17.17 |
| TPSA | 68.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 947.15 |
| LogP ≤ 5 | 17.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |