About [(Z)-tetradec-11-enyl] dihydrogen phosphate
[(Z)-tetradec-11-enyl] dihydrogen phosphate (PubChem CID 58851139) has the molecular formula C14H29O4P
and a molecular weight of 292.36 g/mol. Its IUPAC name is [(Z)-tetradec-11-enyl] dihydrogen phosphate.
Molecular Properties
| Compound Name | [(Z)-tetradec-11-enyl] dihydrogen phosphate |
| PubChem CID | 58851139 |
| Molecular Formula | C14H29O4P |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | [(Z)-tetradec-11-enyl] dihydrogen phosphate |
| SMILES | CC/C=C\CCCCCCCCCCOP(=O)(O)O |
| InChI | InChI=1S/C14H29O4P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-18-19(15,16)17/h3-4H,2,5-14H2,1H3,(H2,15,16,17)/b4-3- |
| InChIKey | VKPRWVOYFUXFAT-ARJAWSKDSA-N |
| XLogP | 4.57 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-tetradec-11-enyl] dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-tetradec-11-enyl] dihydrogen phosphate?
The IUPAC name of [(Z)-tetradec-11-enyl] dihydrogen phosphate (CID 58851139) is [(Z)-tetradec-11-enyl] dihydrogen phosphate.
What is the SMILES notation for [(Z)-tetradec-11-enyl] dihydrogen phosphate?
The canonical SMILES for [(Z)-tetradec-11-enyl] dihydrogen phosphate is CC/C=C\CCCCCCCCCCOP(=O)(O)O.
What is the InChIKey of [(Z)-tetradec-11-enyl] dihydrogen phosphate?
The InChIKey is VKPRWVOYFUXFAT-ARJAWSKDSA-N. The full InChI is InChI=1S/C14H29O4P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-18-19(15,16)17/h3-4H,2,5-14H2,1H3,(H2,15,16,17)/b4-3-.
What are the key properties of [(Z)-tetradec-11-enyl] dihydrogen phosphate?
[(Z)-tetradec-11-enyl] dihydrogen phosphate has a molecular weight of 292.36 g/mol, XLogP of 4.57, 13 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-tetradec-11-enyl] dihydrogen phosphate is sourced from PubChem (CID 58851139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).