C35H41FN6O8 — CID 58852040
ethyl 4-[[(E)-[[4-[2-[1-[(4-ethoxy-4-oxobutyl)carbamoyl]-4-fluoroindol-3-yl]-2-oxoacetyl]piperazin-1-yl]-phenylmethylidene]carbamoyl]amino]butanoate (PubChem CID 58852040) has the molecular formula C35H41FN6O8 and a molecular weight of 692.74 g/mol. Its IUPAC name is ethyl 4-[[(E)-[[4-[2-[1-[(4-ethoxy-4-oxobutyl)carbamoyl]-4-fluoroindol-3-yl]-2-oxoacetyl]piperazin-1-yl]-phenylmethylidene]carbamoyl]amino]butanoate.
| Compound Name | ethyl 4-[[(E)-[[4-[2-[1-[(4-ethoxy-4-oxobutyl)carbamoyl]-4-fluoroindol-3-yl]-2-oxoacetyl]piperazin-1-yl]-phenylmethylidene]carbamoyl]amino]butanoate |
|---|---|
| PubChem CID | 58852040 |
| Molecular Formula | C35H41FN6O8 |
| Molecular Weight | 692.74 g/mol |
| Exact Mass | 692.30 |
| IUPAC Name | ethyl 4-[[(E)-[[4-[2-[1-[(4-ethoxy-4-oxobutyl)carbamoyl]-4-fluoroindol-3-yl]-2-oxoacetyl]piperazin-1-yl]-phenylmethylidene]carbamoyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)/N=C(\c1ccccc1)N1CCN(C(=O)C(=O)c2cn(C(=O)NCCCC(=O)OCC)c3cccc(F)c23)CC1 |
| InChI | InChI=1S/C35H41FN6O8/c1-3-49-28(43)15-9-17-37-34(47)39-32(24-11-6-5-7-12-24)40-19-21-41(22-20-40)33(46)31(45)25-23-42(27-14-8-13-26(36)30(25)27)35(48)38-18-10-16-29(44)50-4-2/h5-8,11-14,23H,3-4,9-10,15-22H2,1-2H3,(H,37,47)(H,38,48)/b39-32+ |
| InChIKey | UORGRCSPXLKJIE-LETMKSKHSA-N |
| XLogP | 3.51 |
| TPSA | 168.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.74 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|