C21H21ClF2N2O — CID 58852363
2-chloro-N-[3-[4-(dimethylamino)cyclohexen-1-yl]-2-fluorophenyl]-6-fluorobenzamide (PubChem CID 58852363) has the molecular formula C21H21ClF2N2O and a molecular weight of 390.86 g/mol. Its IUPAC name is 2-chloro-N-[3-[4-(dimethylamino)cyclohexen-1-yl]-2-fluorophenyl]-6-fluorobenzamide.
| Compound Name | 2-chloro-N-[3-[4-(dimethylamino)cyclohexen-1-yl]-2-fluorophenyl]-6-fluorobenzamide |
|---|---|
| PubChem CID | 58852363 |
| Molecular Formula | C21H21ClF2N2O |
| Molecular Weight | 390.86 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 2-chloro-N-[3-[4-(dimethylamino)cyclohexen-1-yl]-2-fluorophenyl]-6-fluorobenzamide |
| SMILES | CN(C)C1CC=C(c2cccc(NC(=O)c3c(F)cccc3Cl)c2F)CC1 |
| InChI | InChI=1S/C21H21ClF2N2O/c1-26(2)14-11-9-13(10-12-14)15-5-3-8-18(20(15)24)25-21(27)19-16(22)6-4-7-17(19)23/h3-9,14H,10-12H2,1-2H3,(H,25,27) |
| InChIKey | IMWURJOXRIYVKF-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.86 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |