C22H25IN6O7S — CID 58852438
2-[[4-[bis(2-methoxyethyl)amino]-6-(4-sulfoanilino)-1,3,5-triazin-2-yl]amino]-5-iodobenzoic acid (PubChem CID 58852438) has the molecular formula C22H25IN6O7S and a molecular weight of 644.45 g/mol. Its IUPAC name is 2-[[4-[bis(2-methoxyethyl)amino]-6-(4-sulfoanilino)-1,3,5-triazin-2-yl]amino]-5-iodobenzoic acid.
| Compound Name | 2-[[4-[bis(2-methoxyethyl)amino]-6-(4-sulfoanilino)-1,3,5-triazin-2-yl]amino]-5-iodobenzoic acid |
|---|---|
| PubChem CID | 58852438 |
| Molecular Formula | C22H25IN6O7S |
| Molecular Weight | 644.45 g/mol |
| Exact Mass | 644.06 |
| IUPAC Name | 2-[[4-[bis(2-methoxyethyl)amino]-6-(4-sulfoanilino)-1,3,5-triazin-2-yl]amino]-5-iodobenzoic acid |
| SMILES | COCCN(CCOC)c1nc(Nc2ccc(S(=O)(=O)O)cc2)nc(Nc2ccc(I)cc2C(=O)O)n1 |
| InChI | InChI=1S/C22H25IN6O7S/c1-35-11-9-29(10-12-36-2)22-27-20(24-15-4-6-16(7-5-15)37(32,33)34)26-21(28-22)25-18-8-3-14(23)13-17(18)19(30)31/h3-8,13H,9-12H2,1-2H3,(H,30,31)(H,32,33,34)(H2,24,25,26,27,28) |
| InChIKey | CJJYBEGAVKYEEA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 176.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|