About 5,6-bis[4-(4-bromophenyl)phenyl]-2,3-dihydropyrazine
5,6-bis[4-(4-bromophenyl)phenyl]-2,3-dihydropyrazine (PubChem CID 58852573) has the molecular formula C28H20Br2N2
and a molecular weight of 544.29 g/mol. Its IUPAC name is 5,6-bis[4-(4-bromophenyl)phenyl]-2,3-dihydropyrazine.
Molecular Properties
| Compound Name | 5,6-bis[4-(4-bromophenyl)phenyl]-2,3-dihydropyrazine |
| PubChem CID | 58852573 |
| Molecular Formula | C28H20Br2N2 |
| Molecular Weight | 544.29 g/mol |
| Exact Mass | 542.00 |
| IUPAC Name | 5,6-bis[4-(4-bromophenyl)phenyl]-2,3-dihydropyrazine |
| SMILES | Brc1ccc(-c2ccc(C3=NCCN=C3c3ccc(-c4ccc(Br)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C28H20Br2N2/c29-25-13-9-21(10-14-25)19-1-5-23(6-2-19)27-28(32-18-17-31-27)24-7-3-20(4-8-24)22-11-15-26(30)16-12-22/h1-16H,17-18H2 |
| InChIKey | GMKHPATWNUNUNI-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 544.29 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,6-bis[4-(4-bromophenyl)phenyl]-2,3-dihydropyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-bis[4-(4-bromophenyl)phenyl]-2,3-dihydropyrazine?
The IUPAC name of 5,6-bis[4-(4-bromophenyl)phenyl]-2,3-dihydropyrazine (CID 58852573) is 5,6-bis[4-(4-bromophenyl)phenyl]-2,3-dihydropyrazine.
What is the SMILES notation for 5,6-bis[4-(4-bromophenyl)phenyl]-2,3-dihydropyrazine?
The canonical SMILES for 5,6-bis[4-(4-bromophenyl)phenyl]-2,3-dihydropyrazine is Brc1ccc(-c2ccc(C3=NCCN=C3c3ccc(-c4ccc(Br)cc4)cc3)cc2)cc1.
What is the InChIKey of 5,6-bis[4-(4-bromophenyl)phenyl]-2,3-dihydropyrazine?
The InChIKey is GMKHPATWNUNUNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H20Br2N2/c29-25-13-9-21(10-14-25)19-1-5-23(6-2-19)27-28(32-18-17-31-27)24-7-3-20(4-8-24)22-11-15-26(30)16-12-22/h1-16H,17-18H2.
What are the key properties of 5,6-bis[4-(4-bromophenyl)phenyl]-2,3-dihydropyrazine?
5,6-bis[4-(4-bromophenyl)phenyl]-2,3-dihydropyrazine has a molecular weight of 544.29 g/mol, XLogP of 7.84, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-bis[4-(4-bromophenyl)phenyl]-2,3-dihydropyrazine is sourced from PubChem (CID 58852573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).