C5HF12NO6S3 — CID 58852815
1,1,2,2,3,3,4,4-octafluoro-4-(trifluoromethylsulfonylsulfamoyl)butane-1-sulfonyl fluoride (PubChem CID 58852815) has the molecular formula C5HF12NO6S3 and a molecular weight of 495.24 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4-octafluoro-4-(trifluoromethylsulfonylsulfamoyl)butane-1-sulfonyl fluoride.
| Compound Name | 1,1,2,2,3,3,4,4-octafluoro-4-(trifluoromethylsulfonylsulfamoyl)butane-1-sulfonyl fluoride |
|---|---|
| PubChem CID | 58852815 |
| Molecular Formula | C5HF12NO6S3 |
| Molecular Weight | 495.24 g/mol |
| Exact Mass | 494.88 |
| IUPAC Name | 1,1,2,2,3,3,4,4-octafluoro-4-(trifluoromethylsulfonylsulfamoyl)butane-1-sulfonyl fluoride |
| SMILES | O=S(=O)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C5HF12NO6S3/c6-1(7,3(10,11)25(17,19)20)2(8,9)4(12,13)26(21,22)18-27(23,24)5(14,15)16/h18H |
| InChIKey | YPRJJDBEXNOZTN-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 114.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.24 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|