About 1-cyclopenta-1,3-dien-1-yl-4-phenylphthalazine
1-cyclopenta-1,3-dien-1-yl-4-phenylphthalazine (PubChem CID 58854064) has the molecular formula C19H14N2
and a molecular weight of 270.34 g/mol. Its IUPAC name is 1-cyclopenta-1,3-dien-1-yl-4-phenylphthalazine.
Molecular Properties
| Compound Name | 1-cyclopenta-1,3-dien-1-yl-4-phenylphthalazine |
| PubChem CID | 58854064 |
| Molecular Formula | C19H14N2 |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 1-cyclopenta-1,3-dien-1-yl-4-phenylphthalazine |
| SMILES | C1=CCC(c2nnc(-c3ccccc3)c3ccccc23)=C1 |
| InChI | InChI=1S/C19H14N2/c1-2-8-14(9-3-1)18-16-12-6-7-13-17(16)19(21-20-18)15-10-4-5-11-15/h1-10,12-13H,11H2 |
| InChIKey | NIJQDBYRZZDPSF-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclopenta-1,3-dien-1-yl-4-phenylphthalazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopenta-1,3-dien-1-yl-4-phenylphthalazine?
The IUPAC name of 1-cyclopenta-1,3-dien-1-yl-4-phenylphthalazine (CID 58854064) is 1-cyclopenta-1,3-dien-1-yl-4-phenylphthalazine.
What is the SMILES notation for 1-cyclopenta-1,3-dien-1-yl-4-phenylphthalazine?
The canonical SMILES for 1-cyclopenta-1,3-dien-1-yl-4-phenylphthalazine is C1=CCC(c2nnc(-c3ccccc3)c3ccccc23)=C1.
What is the InChIKey of 1-cyclopenta-1,3-dien-1-yl-4-phenylphthalazine?
The InChIKey is NIJQDBYRZZDPSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14N2/c1-2-8-14(9-3-1)18-16-12-6-7-13-17(16)19(21-20-18)15-10-4-5-11-15/h1-10,12-13H,11H2.
What are the key properties of 1-cyclopenta-1,3-dien-1-yl-4-phenylphthalazine?
1-cyclopenta-1,3-dien-1-yl-4-phenylphthalazine has a molecular weight of 270.34 g/mol, XLogP of 4.64, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopenta-1,3-dien-1-yl-4-phenylphthalazine is sourced from PubChem (CID 58854064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).