C16H10F4N6O4 — CID 58854580
N-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-5-methyl-2,4-dinitropyrido[2,3-d]pyrimidin-7-amine (PubChem CID 58854580) has the molecular formula C16H10F4N6O4 and a molecular weight of 426.29 g/mol. Its IUPAC name is N-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-5-methyl-2,4-dinitropyrido[2,3-d]pyrimidin-7-amine.
| Compound Name | N-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-5-methyl-2,4-dinitropyrido[2,3-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 58854580 |
| Molecular Formula | C16H10F4N6O4 |
| Molecular Weight | 426.29 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | N-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-5-methyl-2,4-dinitropyrido[2,3-d]pyrimidin-7-amine |
| SMILES | Cc1cc(NCc2cc(F)cc(C(F)(F)F)c2)nc2nc([N+](=O)[O-])nc([N+](=O)[O-])c12 |
| InChI | InChI=1S/C16H10F4N6O4/c1-7-2-11(21-6-8-3-9(16(18,19)20)5-10(17)4-8)22-13-12(7)14(25(27)28)24-15(23-13)26(29)30/h2-5H,6H2,1H3,(H,21,22,23,24) |
| InChIKey | BLICXJOOJPXSFU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 136.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.29 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|