C19H14F4N6O4 — CID 58854593
N-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-1,3-dinitro-7,8,9,10-tetrahydropyrimido[4,5-c]isoquinolin-6-amine (PubChem CID 58854593) has the molecular formula C19H14F4N6O4 and a molecular weight of 466.35 g/mol. Its IUPAC name is N-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-1,3-dinitro-7,8,9,10-tetrahydropyrimido[4,5-c]isoquinolin-6-amine.
| Compound Name | N-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-1,3-dinitro-7,8,9,10-tetrahydropyrimido[4,5-c]isoquinolin-6-amine |
|---|---|
| PubChem CID | 58854593 |
| Molecular Formula | C19H14F4N6O4 |
| Molecular Weight | 466.35 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | N-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-1,3-dinitro-7,8,9,10-tetrahydropyrimido[4,5-c]isoquinolin-6-amine |
| SMILES | O=[N+]([O-])c1nc([N+](=O)[O-])c2c3c(c(NCc4cc(F)cc(C(F)(F)F)c4)nc2n1)CCCC3 |
| InChI | InChI=1S/C19H14F4N6O4/c20-11-6-9(5-10(7-11)19(21,22)23)8-24-15-13-4-2-1-3-12(13)14-16(25-15)26-18(29(32)33)27-17(14)28(30)31/h5-7H,1-4,8H2,(H,24,25,26,27) |
| InChIKey | GMEALWWVYCWQNB-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 136.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.35 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|