C18H13F3N6O4 — CID 58854613
1,3-dinitro-N-[(3,4,5-trifluorophenyl)methyl]-7,8,9,10-tetrahydropyrimido[4,5-c]isoquinolin-6-amine (PubChem CID 58854613) has the molecular formula C18H13F3N6O4 and a molecular weight of 434.33 g/mol. Its IUPAC name is 1,3-dinitro-N-[(3,4,5-trifluorophenyl)methyl]-7,8,9,10-tetrahydropyrimido[4,5-c]isoquinolin-6-amine.
| Compound Name | 1,3-dinitro-N-[(3,4,5-trifluorophenyl)methyl]-7,8,9,10-tetrahydropyrimido[4,5-c]isoquinolin-6-amine |
|---|---|
| PubChem CID | 58854613 |
| Molecular Formula | C18H13F3N6O4 |
| Molecular Weight | 434.33 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | 1,3-dinitro-N-[(3,4,5-trifluorophenyl)methyl]-7,8,9,10-tetrahydropyrimido[4,5-c]isoquinolin-6-amine |
| SMILES | O=[N+]([O-])c1nc([N+](=O)[O-])c2c3c(c(NCc4cc(F)c(F)c(F)c4)nc2n1)CCCC3 |
| InChI | InChI=1S/C18H13F3N6O4/c19-11-5-8(6-12(20)14(11)21)7-22-15-10-4-2-1-3-9(10)13-16(23-15)24-18(27(30)31)25-17(13)26(28)29/h5-6H,1-4,7H2,(H,22,23,24,25) |
| InChIKey | QNEQXMBKMLWHAT-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 136.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.33 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|