C38H14F16O4S — CID 58854794
1,2,4,5-tetrafluoro-3-methyl-6-[2,3,5,6-tetrafluoro-4-[4-[4-[2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methylphenyl)phenoxy]phenyl]sulfonylphenoxy]phenyl]benzene (PubChem CID 58854794) has the molecular formula C38H14F16O4S and a molecular weight of 870.56 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3-methyl-6-[2,3,5,6-tetrafluoro-4-[4-[4-[2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methylphenyl)phenoxy]phenyl]sulfonylphenoxy]phenyl]benzene.
| Compound Name | 1,2,4,5-tetrafluoro-3-methyl-6-[2,3,5,6-tetrafluoro-4-[4-[4-[2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methylphenyl)phenoxy]phenyl]sulfonylphenoxy]phenyl]benzene |
|---|---|
| PubChem CID | 58854794 |
| Molecular Formula | C38H14F16O4S |
| Molecular Weight | 870.56 g/mol |
| Exact Mass | 870.04 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3-methyl-6-[2,3,5,6-tetrafluoro-4-[4-[4-[2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methylphenyl)phenoxy]phenyl]sulfonylphenoxy]phenyl]benzene |
| SMILES | Cc1c(F)c(F)c(-c2c(F)c(F)c(Oc3ccc(S(=O)(=O)c4ccc(Oc5c(F)c(F)c(-c6c(F)c(F)c(C)c(F)c6F)c(F)c5F)cc4)cc3)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C38H14F16O4S/c1-11-21(39)25(43)17(26(44)22(11)40)19-29(47)33(51)37(34(52)30(19)48)57-13-3-7-15(8-4-13)59(55,56)16-9-5-14(6-10-16)58-38-35(53)31(49)20(32(50)36(38)54)18-27(45)23(41)12(2)24(42)28(18)46/h3-10H,1-2H3 |
| InChIKey | UJGAAQSOKSMFTM-UHFFFAOYSA-N |
| XLogP | 12.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 870.56 |
| LogP ≤ 5 | 12.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|