C16H19F7O — CID 58854818
2-[1-[(E)-3-cyclohexylprop-2-enyl]-3-fluorocyclobut-2-en-1-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 58854818) has the molecular formula C16H19F7O and a molecular weight of 360.31 g/mol. Its IUPAC name is 2-[1-[(E)-3-cyclohexylprop-2-enyl]-3-fluorocyclobut-2-en-1-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[1-[(E)-3-cyclohexylprop-2-enyl]-3-fluorocyclobut-2-en-1-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 58854818 |
| Molecular Formula | C16H19F7O |
| Molecular Weight | 360.31 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 2-[1-[(E)-3-cyclohexylprop-2-enyl]-3-fluorocyclobut-2-en-1-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | OC(C(F)(F)F)(C(F)(F)F)C1(C/C=C/C2CCCCC2)C=C(F)C1 |
| InChI | InChI=1S/C16H19F7O/c17-12-9-13(10-12,8-4-7-11-5-2-1-3-6-11)14(24,15(18,19)20)16(21,22)23/h4,7,9,11,24H,1-3,5-6,8,10H2/b7-4+ |
| InChIKey | ILPHNRZFXRFZAB-QPJJXVBHSA-N |
| XLogP | 5.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.31 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|