C11H8F10O — CID 58854820
1,1,1,3,3,3-hexafluoro-2-[3-fluoro-1-[(E)-4,4,4-trifluorobut-2-enyl]cyclobut-2-en-1-yl]propan-2-ol (PubChem CID 58854820) has the molecular formula C11H8F10O and a molecular weight of 346.16 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[3-fluoro-1-[(E)-4,4,4-trifluorobut-2-enyl]cyclobut-2-en-1-yl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[3-fluoro-1-[(E)-4,4,4-trifluorobut-2-enyl]cyclobut-2-en-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 58854820 |
| Molecular Formula | C11H8F10O |
| Molecular Weight | 346.16 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[3-fluoro-1-[(E)-4,4,4-trifluorobut-2-enyl]cyclobut-2-en-1-yl]propan-2-ol |
| SMILES | OC(C(F)(F)F)(C(F)(F)F)C1(C/C=C/C(F)(F)F)C=C(F)C1 |
| InChI | InChI=1S/C11H8F10O/c12-6-4-7(5-6,2-1-3-8(13,14)15)9(22,10(16,17)18)11(19,20)21/h1,3-4,22H,2,5H2/b3-1+ |
| InChIKey | INFJUJGOEJDYAB-HNQUOIGGSA-N |
| XLogP | 4.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.16 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|