C30H24F10 — CID 58854972
5,5,6,7,7,12,12,13,14,14-decafluoro-1,2,3,4,8,9,10,11-octamethylpentacene (PubChem CID 58854972) has the molecular formula C30H24F10 and a molecular weight of 574.50 g/mol. Its IUPAC name is 5,5,6,7,7,12,12,13,14,14-decafluoro-1,2,3,4,8,9,10,11-octamethylpentacene.
| Compound Name | 5,5,6,7,7,12,12,13,14,14-decafluoro-1,2,3,4,8,9,10,11-octamethylpentacene |
|---|---|
| PubChem CID | 58854972 |
| Molecular Formula | C30H24F10 |
| Molecular Weight | 574.50 g/mol |
| Exact Mass | 574.17 |
| IUPAC Name | 5,5,6,7,7,12,12,13,14,14-decafluoro-1,2,3,4,8,9,10,11-octamethylpentacene |
| SMILES | Cc1c(C)c(C)c2c(c1C)C(F)(F)c1c(F)c3c(c(F)c1C2(F)F)C(F)(F)c1c(C)c(C)c(C)c(C)c1C3(F)F |
| InChI | InChI=1S/C30H24F10/c1-9-10(2)14(6)18-17(13(9)5)27(33,34)21-22(28(18,35)36)26(32)24-23(25(21)31)29(37,38)19-15(7)11(3)12(4)16(8)20(19)30(24,39)40/h1-8H3 |
| InChIKey | LPTBQBCWRFQMMZ-UHFFFAOYSA-N |
| XLogP | 9.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.50 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |