C10H16O2 — CID 58855001
(2Z,4E,8Z)-6-hydroperoxydeca-2,4,8-triene (PubChem CID 58855001) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is (2Z,4E,8Z)-6-hydroperoxydeca-2,4,8-triene.
| Compound Name | (2Z,4E,8Z)-6-hydroperoxydeca-2,4,8-triene |
|---|---|
| PubChem CID | 58855001 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | (2Z,4E,8Z)-6-hydroperoxydeca-2,4,8-triene |
| SMILES | C/C=C\C=C\C(C/C=C\C)OO |
| InChI | InChI=1S/C10H16O2/c1-3-5-7-9-10(12-11)8-6-4-2/h3-7,9-11H,8H2,1-2H3/b5-3-,6-4-,9-7+ |
| InChIKey | LUEHCNWJLFTNQA-AQJMMWSSSA-N |
| XLogP | 2.94 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|