C24H14O2S2 — CID 58855034
4,11-dithiophen-2-yltetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9(14),10,12-hexaene-15,16-dione (PubChem CID 58855034) has the molecular formula C24H14O2S2 and a molecular weight of 398.51 g/mol. Its IUPAC name is 4,11-dithiophen-2-yltetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9(14),10,12-hexaene-15,16-dione.
| Compound Name | 4,11-dithiophen-2-yltetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9(14),10,12-hexaene-15,16-dione |
|---|---|
| PubChem CID | 58855034 |
| Molecular Formula | C24H14O2S2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | 4,11-dithiophen-2-yltetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9(14),10,12-hexaene-15,16-dione |
| SMILES | O=C1C(=O)C2c3ccc(-c4cccs4)cc3C1c1ccc(-c3cccs3)cc12 |
| InChI | InChI=1S/C24H14O2S2/c25-23-21-16-8-6-14(20-4-2-10-28-20)12-18(16)22(24(23)26)15-7-5-13(11-17(15)21)19-3-1-9-27-19/h1-12,21-22H |
| InChIKey | YIVXGXYLLZGXRW-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|