C28H30N2O5 — CID 58855099
5-[1,3-dioxo-2-[(1,3,3,5-tetramethylcyclohexyl)methyl]isoindol-5-yl]oxy-2-methylisoindole-1,3-dione (PubChem CID 58855099) has the molecular formula C28H30N2O5 and a molecular weight of 474.56 g/mol. Its IUPAC name is 5-[1,3-dioxo-2-[(1,3,3,5-tetramethylcyclohexyl)methyl]isoindol-5-yl]oxy-2-methylisoindole-1,3-dione.
| Compound Name | 5-[1,3-dioxo-2-[(1,3,3,5-tetramethylcyclohexyl)methyl]isoindol-5-yl]oxy-2-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 58855099 |
| Molecular Formula | C28H30N2O5 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | 5-[1,3-dioxo-2-[(1,3,3,5-tetramethylcyclohexyl)methyl]isoindol-5-yl]oxy-2-methylisoindole-1,3-dione |
| SMILES | CC1CC(C)(C)CC(C)(CN2C(=O)c3ccc(Oc4ccc5c(c4)C(=O)N(C)C5=O)cc3C2=O)C1 |
| InChI | InChI=1S/C28H30N2O5/c1-16-12-27(2,3)14-28(4,13-16)15-30-25(33)20-9-7-18(11-22(20)26(30)34)35-17-6-8-19-21(10-17)24(32)29(5)23(19)31/h6-11,16H,12-15H2,1-5H3 |
| InChIKey | LXASZACXVZGLQZ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|