C42H38N4 — CID 58855110
2-N,6-N-bis(3,5-dimethylphenyl)-9,10-dimethyl-2-N,6-N-dipyridin-2-ylanthracene-2,6-diamine (PubChem CID 58855110) has the molecular formula C42H38N4 and a molecular weight of 598.79 g/mol. Its IUPAC name is 2-N,6-N-bis(3,5-dimethylphenyl)-9,10-dimethyl-2-N,6-N-dipyridin-2-ylanthracene-2,6-diamine.
| Compound Name | 2-N,6-N-bis(3,5-dimethylphenyl)-9,10-dimethyl-2-N,6-N-dipyridin-2-ylanthracene-2,6-diamine |
|---|---|
| PubChem CID | 58855110 |
| Molecular Formula | C42H38N4 |
| Molecular Weight | 598.79 g/mol |
| Exact Mass | 598.31 |
| IUPAC Name | 2-N,6-N-bis(3,5-dimethylphenyl)-9,10-dimethyl-2-N,6-N-dipyridin-2-ylanthracene-2,6-diamine |
| SMILES | Cc1cc(C)cc(N(c2ccc3c(C)c4cc(N(c5cc(C)cc(C)c5)c5ccccn5)ccc4c(C)c3c2)c2ccccn2)c1 |
| InChI | InChI=1S/C42H38N4/c1-27-19-28(2)22-35(21-27)45(41-11-7-9-17-43-41)33-13-15-37-32(6)40-26-34(14-16-38(40)31(5)39(37)25-33)46(42-12-8-10-18-44-42)36-23-29(3)20-30(4)24-36/h7-26H,1-6H3 |
| InChIKey | CVWQHEMRCOSRPD-UHFFFAOYSA-N |
| XLogP | 11.57 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.79 |
| LogP ≤ 5 | 11.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|