C68H58N4 — CID 58855137
9,10-bis(4-phenylphenyl)-2-N,6-N-dipyridin-2-yl-2-N,6-N-bis(2,3,5,6-tetramethylphenyl)anthracene-2,6-diamine (PubChem CID 58855137) has the molecular formula C68H58N4 and a molecular weight of 931.24 g/mol. Its IUPAC name is 9,10-bis(4-phenylphenyl)-2-N,6-N-dipyridin-2-yl-2-N,6-N-bis(2,3,5,6-tetramethylphenyl)anthracene-2,6-diamine.
| Compound Name | 9,10-bis(4-phenylphenyl)-2-N,6-N-dipyridin-2-yl-2-N,6-N-bis(2,3,5,6-tetramethylphenyl)anthracene-2,6-diamine |
|---|---|
| PubChem CID | 58855137 |
| Molecular Formula | C68H58N4 |
| Molecular Weight | 931.24 g/mol |
| Exact Mass | 930.47 |
| IUPAC Name | 9,10-bis(4-phenylphenyl)-2-N,6-N-dipyridin-2-yl-2-N,6-N-bis(2,3,5,6-tetramethylphenyl)anthracene-2,6-diamine |
| SMILES | Cc1cc(C)c(C)c(N(c2ccc3c(-c4ccc(-c5ccccc5)cc4)c4cc(N(c5ccccn5)c5c(C)c(C)cc(C)c5C)ccc4c(-c4ccc(-c5ccccc5)cc4)c3c2)c2ccccn2)c1C |
| InChI | InChI=1S/C68H58N4/c1-43-39-44(2)48(6)67(47(43)5)71(63-23-15-17-37-69-63)57-33-35-59-61(41-57)65(55-29-25-53(26-30-55)51-19-11-9-12-20-51)60-36-34-58(42-62(60)66(59)56-31-27-54(28-32-56)52-21-13-10-14-22-52)72(64-24-16-18-38-70-64)68-49(7)45(3)40-46(4)50(68)8/h9-42H,1-8H3 |
| InChIKey | WPEIXFWVJTYLIA-UHFFFAOYSA-N |
| XLogP | 18.86 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 931.24 |
| LogP ≤ 5 | 18.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|