C58H52N2O4 — CID 58855173
9,10-bis(3,5-dimethylphenyl)-2-N,2-N,6-N,6-N-tetrakis(4-methoxyphenyl)anthracene-2,6-diamine (PubChem CID 58855173) has the molecular formula C58H52N2O4 and a molecular weight of 841.06 g/mol. Its IUPAC name is 9,10-bis(3,5-dimethylphenyl)-2-N,2-N,6-N,6-N-tetrakis(4-methoxyphenyl)anthracene-2,6-diamine.
| Compound Name | 9,10-bis(3,5-dimethylphenyl)-2-N,2-N,6-N,6-N-tetrakis(4-methoxyphenyl)anthracene-2,6-diamine |
|---|---|
| PubChem CID | 58855173 |
| Molecular Formula | C58H52N2O4 |
| Molecular Weight | 841.06 g/mol |
| Exact Mass | 840.39 |
| IUPAC Name | 9,10-bis(3,5-dimethylphenyl)-2-N,2-N,6-N,6-N-tetrakis(4-methoxyphenyl)anthracene-2,6-diamine |
| SMILES | COc1ccc(N(c2ccc(OC)cc2)c2ccc3c(-c4cc(C)cc(C)c4)c4cc(N(c5ccc(OC)cc5)c5ccc(OC)cc5)ccc4c(-c4cc(C)cc(C)c4)c3c2)cc1 |
| InChI | InChI=1S/C58H52N2O4/c1-37-29-38(2)32-41(31-37)57-53-27-17-48(60(45-13-23-51(63-7)24-14-45)46-15-25-52(64-8)26-16-46)36-56(53)58(42-33-39(3)30-40(4)34-42)54-28-18-47(35-55(54)57)59(43-9-19-49(61-5)20-10-43)44-11-21-50(62-6)22-12-44/h9-36H,1-8H3 |
| InChIKey | LSRSKSCGRRHGLE-UHFFFAOYSA-N |
| XLogP | 15.53 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.06 |
| LogP ≤ 5 | 15.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|