C12H13F11N2O2 — CID 58855377
2,2,3,3,4,4,5,5,6,6,6-undecafluoro-N-(2-morpholin-4-ylethyl)hexanamide (PubChem CID 58855377) has the molecular formula C12H13F11N2O2 and a molecular weight of 426.23 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,6-undecafluoro-N-(2-morpholin-4-ylethyl)hexanamide.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,6-undecafluoro-N-(2-morpholin-4-ylethyl)hexanamide |
|---|---|
| PubChem CID | 58855377 |
| Molecular Formula | C12H13F11N2O2 |
| Molecular Weight | 426.23 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,6-undecafluoro-N-(2-morpholin-4-ylethyl)hexanamide |
| SMILES | O=C(NCCN1CCOCC1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H13F11N2O2/c13-8(14,7(26)24-1-2-25-3-5-27-6-4-25)9(15,16)10(17,18)11(19,20)12(21,22)23/h1-6H2,(H,24,26) |
| InChIKey | CEMHJSITIKHEMI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.23 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|