C15H22F7NO4 — CID 58855392
[4,4,5,5,7,7,7-heptafluoro-1-(2-morpholin-4-ylethoxy)heptan-2-yl] acetate (PubChem CID 58855392) has the molecular formula C15H22F7NO4 and a molecular weight of 413.33 g/mol. Its IUPAC name is [4,4,5,5,7,7,7-heptafluoro-1-(2-morpholin-4-ylethoxy)heptan-2-yl] acetate.
| Compound Name | [4,4,5,5,7,7,7-heptafluoro-1-(2-morpholin-4-ylethoxy)heptan-2-yl] acetate |
|---|---|
| PubChem CID | 58855392 |
| Molecular Formula | C15H22F7NO4 |
| Molecular Weight | 413.33 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | [4,4,5,5,7,7,7-heptafluoro-1-(2-morpholin-4-ylethoxy)heptan-2-yl] acetate |
| SMILES | CC(=O)OC(COCCN1CCOCC1)CC(F)(F)C(F)(F)CC(F)(F)F |
| InChI | InChI=1S/C15H22F7NO4/c1-11(24)27-12(9-26-7-4-23-2-5-25-6-3-23)8-13(16,17)14(18,19)10-15(20,21)22/h12H,2-10H2,1H3 |
| InChIKey | SLGJLACPUDMFSM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|