C14H19F8NO4 — CID 58855397
[1-morpholin-4-yl-3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propan-2-yl] acetate (PubChem CID 58855397) has the molecular formula C14H19F8NO4 and a molecular weight of 417.29 g/mol. Its IUPAC name is [1-morpholin-4-yl-3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propan-2-yl] acetate.
| Compound Name | [1-morpholin-4-yl-3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propan-2-yl] acetate |
|---|---|
| PubChem CID | 58855397 |
| Molecular Formula | C14H19F8NO4 |
| Molecular Weight | 417.29 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | [1-morpholin-4-yl-3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propan-2-yl] acetate |
| SMILES | CC(=O)OC(COCC(F)(F)C(F)(F)C(F)(F)C(F)F)CN1CCOCC1 |
| InChI | InChI=1S/C14H19F8NO4/c1-9(24)27-10(6-23-2-4-25-5-3-23)7-26-8-12(17,18)14(21,22)13(19,20)11(15)16/h10-11H,2-8H2,1H3 |
| InChIKey | DQCAFJGQXRSWSV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|