C18H22F13NO4 — CID 58855401
[4,4,5,5,7,7,7-heptafluoro-1-(2-morpholin-4-ylethoxy)heptan-2-yl] 3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propanoate (PubChem CID 58855401) has the molecular formula C18H22F13NO4 and a molecular weight of 563.35 g/mol. Its IUPAC name is [4,4,5,5,7,7,7-heptafluoro-1-(2-morpholin-4-ylethoxy)heptan-2-yl] 3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propanoate.
| Compound Name | [4,4,5,5,7,7,7-heptafluoro-1-(2-morpholin-4-ylethoxy)heptan-2-yl] 3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propanoate |
|---|---|
| PubChem CID | 58855401 |
| Molecular Formula | C18H22F13NO4 |
| Molecular Weight | 563.35 g/mol |
| Exact Mass | 563.13 |
| IUPAC Name | [4,4,5,5,7,7,7-heptafluoro-1-(2-morpholin-4-ylethoxy)heptan-2-yl] 3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propanoate |
| SMILES | CC(C(=O)OC(COCCN1CCOCC1)CC(F)(F)C(F)(F)CC(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H22F13NO4/c1-13(17(26,27)28,18(29,30)31)12(33)36-11(9-35-7-4-32-2-5-34-6-3-32)8-14(19,20)15(21,22)10-16(23,24)25/h11H,2-10H2,1H3 |
| InChIKey | WXMLDCJCFGIYTA-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.35 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|