C13H16F11NO2 — CID 58855406
4,4,6,6,7,7,8,8,9,9,9-undecafluoro-1-morpholin-4-ylnonan-2-ol (PubChem CID 58855406) has the molecular formula C13H16F11NO2 and a molecular weight of 427.25 g/mol. Its IUPAC name is 4,4,6,6,7,7,8,8,9,9,9-undecafluoro-1-morpholin-4-ylnonan-2-ol.
| Compound Name | 4,4,6,6,7,7,8,8,9,9,9-undecafluoro-1-morpholin-4-ylnonan-2-ol |
|---|---|
| PubChem CID | 58855406 |
| Molecular Formula | C13H16F11NO2 |
| Molecular Weight | 427.25 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 4,4,6,6,7,7,8,8,9,9,9-undecafluoro-1-morpholin-4-ylnonan-2-ol |
| SMILES | OC(CN1CCOCC1)CC(F)(F)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H16F11NO2/c14-9(15,5-8(26)6-25-1-3-27-4-2-25)7-10(16,17)11(18,19)12(20,21)13(22,23)24/h8,26H,1-7H2 |
| InChIKey | VEMXKAQPJFXNNU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.25 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|