C15H18F11NO3 — CID 58855412
(4,4,6,6,7,7,8,8,9,9,9-undecafluoro-1-morpholin-4-ylnonan-2-yl) acetate (PubChem CID 58855412) has the molecular formula C15H18F11NO3 and a molecular weight of 469.29 g/mol. Its IUPAC name is (4,4,6,6,7,7,8,8,9,9,9-undecafluoro-1-morpholin-4-ylnonan-2-yl) acetate.
| Compound Name | (4,4,6,6,7,7,8,8,9,9,9-undecafluoro-1-morpholin-4-ylnonan-2-yl) acetate |
|---|---|
| PubChem CID | 58855412 |
| Molecular Formula | C15H18F11NO3 |
| Molecular Weight | 469.29 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | (4,4,6,6,7,7,8,8,9,9,9-undecafluoro-1-morpholin-4-ylnonan-2-yl) acetate |
| SMILES | CC(=O)OC(CN1CCOCC1)CC(F)(F)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H18F11NO3/c1-9(28)30-10(7-27-2-4-29-5-3-27)6-11(16,17)8-12(18,19)13(20,21)14(22,23)15(24,25)26/h10H,2-8H2,1H3 |
| InChIKey | HWMVYEKAYRDEOW-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.29 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|