C10H16F4N2O2 — CID 58855415
2,2,3,3-tetrafluoro-N-methyl-N-(2-morpholin-4-ylethyl)propanamide (PubChem CID 58855415) has the molecular formula C10H16F4N2O2 and a molecular weight of 272.24 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-methyl-N-(2-morpholin-4-ylethyl)propanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-methyl-N-(2-morpholin-4-ylethyl)propanamide |
|---|---|
| PubChem CID | 58855415 |
| Molecular Formula | C10H16F4N2O2 |
| Molecular Weight | 272.24 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-methyl-N-(2-morpholin-4-ylethyl)propanamide |
| SMILES | CN(CCN1CCOCC1)C(=O)C(F)(F)C(F)F |
| InChI | InChI=1S/C10H16F4N2O2/c1-15(9(17)10(13,14)8(11)12)2-3-16-4-6-18-7-5-16/h8H,2-7H2,1H3 |
| InChIKey | ZJWJNEJCAAVTDL-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.24 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|