C16H20F11NO4 — CID 58855418
[4,4,5,5,6,7,7,7-octafluoro-1-(2-morpholin-4-ylethoxy)-6-(trifluoromethyl)heptan-2-yl] acetate (PubChem CID 58855418) has the molecular formula C16H20F11NO4 and a molecular weight of 499.32 g/mol. Its IUPAC name is [4,4,5,5,6,7,7,7-octafluoro-1-(2-morpholin-4-ylethoxy)-6-(trifluoromethyl)heptan-2-yl] acetate.
| Compound Name | [4,4,5,5,6,7,7,7-octafluoro-1-(2-morpholin-4-ylethoxy)-6-(trifluoromethyl)heptan-2-yl] acetate |
|---|---|
| PubChem CID | 58855418 |
| Molecular Formula | C16H20F11NO4 |
| Molecular Weight | 499.32 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | [4,4,5,5,6,7,7,7-octafluoro-1-(2-morpholin-4-ylethoxy)-6-(trifluoromethyl)heptan-2-yl] acetate |
| SMILES | CC(=O)OC(COCCN1CCOCC1)CC(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H20F11NO4/c1-10(29)32-11(9-31-7-4-28-2-5-30-6-3-28)8-12(17,18)14(20,21)13(19,15(22,23)24)16(25,26)27/h11H,2-9H2,1H3 |
| InChIKey | XSQUMGVKAGDLCE-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.32 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|