C17H26F7NO4 — CID 58855421
[4,4,5,5,7,7,7-heptafluoro-1-(2-morpholin-4-ylethoxy)heptan-2-yl] butanoate (PubChem CID 58855421) has the molecular formula C17H26F7NO4 and a molecular weight of 441.38 g/mol. Its IUPAC name is [4,4,5,5,7,7,7-heptafluoro-1-(2-morpholin-4-ylethoxy)heptan-2-yl] butanoate.
| Compound Name | [4,4,5,5,7,7,7-heptafluoro-1-(2-morpholin-4-ylethoxy)heptan-2-yl] butanoate |
|---|---|
| PubChem CID | 58855421 |
| Molecular Formula | C17H26F7NO4 |
| Molecular Weight | 441.38 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | [4,4,5,5,7,7,7-heptafluoro-1-(2-morpholin-4-ylethoxy)heptan-2-yl] butanoate |
| SMILES | CCCC(=O)OC(COCCN1CCOCC1)CC(F)(F)C(F)(F)CC(F)(F)F |
| InChI | InChI=1S/C17H26F7NO4/c1-2-3-14(26)29-13(11-28-9-6-25-4-7-27-8-5-25)10-15(18,19)16(20,21)12-17(22,23)24/h13H,2-12H2,1H3 |
| InChIKey | ODVDHIHUJZZMKE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|