C15H16F15NO2 — CID 58855426
4,4,6,6,7,7,8,8,9,9,10,10,11,11,11-pentadecafluoro-1-morpholin-4-ylundecan-2-ol (PubChem CID 58855426) has the molecular formula C15H16F15NO2 and a molecular weight of 527.27 g/mol. Its IUPAC name is 4,4,6,6,7,7,8,8,9,9,10,10,11,11,11-pentadecafluoro-1-morpholin-4-ylundecan-2-ol.
| Compound Name | 4,4,6,6,7,7,8,8,9,9,10,10,11,11,11-pentadecafluoro-1-morpholin-4-ylundecan-2-ol |
|---|---|
| PubChem CID | 58855426 |
| Molecular Formula | C15H16F15NO2 |
| Molecular Weight | 527.27 g/mol |
| Exact Mass | 527.09 |
| IUPAC Name | 4,4,6,6,7,7,8,8,9,9,10,10,11,11,11-pentadecafluoro-1-morpholin-4-ylundecan-2-ol |
| SMILES | OC(CN1CCOCC1)CC(F)(F)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H16F15NO2/c16-9(17,5-8(32)6-31-1-3-33-4-2-31)7-10(18,19)11(20,21)12(22,23)13(24,25)14(26,27)15(28,29)30/h8,32H,1-7H2 |
| InChIKey | VHFFYWIMHYLEFC-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.27 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|