C12H19F4NO4 — CID 58855433
[1-morpholin-4-yl-3-(2,2,3,3-tetrafluoropropoxy)propan-2-yl] acetate (PubChem CID 58855433) has the molecular formula C12H19F4NO4 and a molecular weight of 317.28 g/mol. Its IUPAC name is [1-morpholin-4-yl-3-(2,2,3,3-tetrafluoropropoxy)propan-2-yl] acetate.
| Compound Name | [1-morpholin-4-yl-3-(2,2,3,3-tetrafluoropropoxy)propan-2-yl] acetate |
|---|---|
| PubChem CID | 58855433 |
| Molecular Formula | C12H19F4NO4 |
| Molecular Weight | 317.28 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | [1-morpholin-4-yl-3-(2,2,3,3-tetrafluoropropoxy)propan-2-yl] acetate |
| SMILES | CC(=O)OC(COCC(F)(F)C(F)F)CN1CCOCC1 |
| InChI | InChI=1S/C12H19F4NO4/c1-9(18)21-10(6-17-2-4-19-5-3-17)7-20-8-12(15,16)11(13)14/h10-11H,2-8H2,1H3 |
| InChIKey | QLBROOHXCOJDSX-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.28 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|