C21H34F7NO4 — CID 58855445
[4,4,5,5,7,7,7-heptafluoro-1-(2-morpholin-4-ylethoxy)heptan-2-yl] octanoate (PubChem CID 58855445) has the molecular formula C21H34F7NO4 and a molecular weight of 497.49 g/mol. Its IUPAC name is [4,4,5,5,7,7,7-heptafluoro-1-(2-morpholin-4-ylethoxy)heptan-2-yl] octanoate.
| Compound Name | [4,4,5,5,7,7,7-heptafluoro-1-(2-morpholin-4-ylethoxy)heptan-2-yl] octanoate |
|---|---|
| PubChem CID | 58855445 |
| Molecular Formula | C21H34F7NO4 |
| Molecular Weight | 497.49 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | [4,4,5,5,7,7,7-heptafluoro-1-(2-morpholin-4-ylethoxy)heptan-2-yl] octanoate |
| SMILES | CCCCCCCC(=O)OC(COCCN1CCOCC1)CC(F)(F)C(F)(F)CC(F)(F)F |
| InChI | InChI=1S/C21H34F7NO4/c1-2-3-4-5-6-7-18(30)33-17(15-32-13-10-29-8-11-31-12-9-29)14-19(22,23)20(24,25)16-21(26,27)28/h17H,2-16H2,1H3 |
| InChIKey | WACSLSQLJBMBAE-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.49 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|