C10H17F4NO3 — CID 58855446
1-morpholin-4-yl-3-(2,2,3,3-tetrafluoropropoxy)propan-2-ol (PubChem CID 58855446) has the molecular formula C10H17F4NO3 and a molecular weight of 275.24 g/mol. Its IUPAC name is 1-morpholin-4-yl-3-(2,2,3,3-tetrafluoropropoxy)propan-2-ol.
| Compound Name | 1-morpholin-4-yl-3-(2,2,3,3-tetrafluoropropoxy)propan-2-ol |
|---|---|
| PubChem CID | 58855446 |
| Molecular Formula | C10H17F4NO3 |
| Molecular Weight | 275.24 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 1-morpholin-4-yl-3-(2,2,3,3-tetrafluoropropoxy)propan-2-ol |
| SMILES | OC(COCC(F)(F)C(F)F)CN1CCOCC1 |
| InChI | InChI=1S/C10H17F4NO3/c11-9(12)10(13,14)7-18-6-8(16)5-15-1-3-17-4-2-15/h8-9,16H,1-7H2 |
| InChIKey | MXFATWKIEVSDKQ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.24 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|