C15H19F10NO4 — CID 58855450
[4,4,5,5,7,7,7-heptafluoro-1-(2-morpholin-4-ylethoxy)heptan-2-yl] 2,2,2-trifluoroacetate (PubChem CID 58855450) has the molecular formula C15H19F10NO4 and a molecular weight of 467.30 g/mol. Its IUPAC name is [4,4,5,5,7,7,7-heptafluoro-1-(2-morpholin-4-ylethoxy)heptan-2-yl] 2,2,2-trifluoroacetate.
| Compound Name | [4,4,5,5,7,7,7-heptafluoro-1-(2-morpholin-4-ylethoxy)heptan-2-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 58855450 |
| Molecular Formula | C15H19F10NO4 |
| Molecular Weight | 467.30 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | [4,4,5,5,7,7,7-heptafluoro-1-(2-morpholin-4-ylethoxy)heptan-2-yl] 2,2,2-trifluoroacetate |
| SMILES | O=C(OC(COCCN1CCOCC1)CC(F)(F)C(F)(F)CC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H19F10NO4/c16-12(17,13(18,19)9-14(20,21)22)7-10(30-11(27)15(23,24)25)8-29-6-3-26-1-4-28-5-2-26/h10H,1-9H2 |
| InChIKey | HZSGICBMUNLSLA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.30 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|