C16H19F12NO4 — CID 58855460
[1-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-3-morpholin-4-ylpropan-2-yl] acetate (PubChem CID 58855460) has the molecular formula C16H19F12NO4 and a molecular weight of 517.31 g/mol. Its IUPAC name is [1-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-3-morpholin-4-ylpropan-2-yl] acetate.
| Compound Name | [1-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-3-morpholin-4-ylpropan-2-yl] acetate |
|---|---|
| PubChem CID | 58855460 |
| Molecular Formula | C16H19F12NO4 |
| Molecular Weight | 517.31 g/mol |
| Exact Mass | 517.11 |
| IUPAC Name | [1-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-3-morpholin-4-ylpropan-2-yl] acetate |
| SMILES | CC(=O)OC(COCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)CN1CCOCC1 |
| InChI | InChI=1S/C16H19F12NO4/c1-9(30)33-10(6-29-2-4-31-5-3-29)7-32-8-12(19,20)14(23,24)16(27,28)15(25,26)13(21,22)11(17)18/h10-11H,2-8H2,1H3 |
| InChIKey | IWQMZFDJYNLRPL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.31 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|