C16H16F17NO2 — CID 58855487
4,4,6,6,7,7,8,8,9,9,10,11,11,11-tetradecafluoro-1-morpholin-4-yl-10-(trifluoromethyl)undecan-2-ol (PubChem CID 58855487) has the molecular formula C16H16F17NO2 and a molecular weight of 577.28 g/mol. Its IUPAC name is 4,4,6,6,7,7,8,8,9,9,10,11,11,11-tetradecafluoro-1-morpholin-4-yl-10-(trifluoromethyl)undecan-2-ol.
| Compound Name | 4,4,6,6,7,7,8,8,9,9,10,11,11,11-tetradecafluoro-1-morpholin-4-yl-10-(trifluoromethyl)undecan-2-ol |
|---|---|
| PubChem CID | 58855487 |
| Molecular Formula | C16H16F17NO2 |
| Molecular Weight | 577.28 g/mol |
| Exact Mass | 577.09 |
| IUPAC Name | 4,4,6,6,7,7,8,8,9,9,10,11,11,11-tetradecafluoro-1-morpholin-4-yl-10-(trifluoromethyl)undecan-2-ol |
| SMILES | OC(CN1CCOCC1)CC(F)(F)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H16F17NO2/c17-9(18,5-8(35)6-34-1-3-36-4-2-34)7-10(19,20)12(22,23)14(26,27)13(24,25)11(21,15(28,29)30)16(31,32)33/h8,35H,1-7H2 |
| InChIKey | XBQUWUCTGUFHEK-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.28 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|