C18H28F7NO4 — CID 58855495
[4,4,5,5,7,7,7-heptafluoro-1-(2-morpholin-4-ylethoxy)heptan-2-yl] 2,2-dimethylpropanoate (PubChem CID 58855495) has the molecular formula C18H28F7NO4 and a molecular weight of 455.41 g/mol. Its IUPAC name is [4,4,5,5,7,7,7-heptafluoro-1-(2-morpholin-4-ylethoxy)heptan-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [4,4,5,5,7,7,7-heptafluoro-1-(2-morpholin-4-ylethoxy)heptan-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 58855495 |
| Molecular Formula | C18H28F7NO4 |
| Molecular Weight | 455.41 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | [4,4,5,5,7,7,7-heptafluoro-1-(2-morpholin-4-ylethoxy)heptan-2-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC(COCCN1CCOCC1)CC(F)(F)C(F)(F)CC(F)(F)F |
| InChI | InChI=1S/C18H28F7NO4/c1-15(2,3)14(27)30-13(11-29-9-6-26-4-7-28-8-5-26)10-16(19,20)17(21,22)12-18(23,24)25/h13H,4-12H2,1-3H3 |
| InChIKey | NLGTWMDAYWBHFA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|