C11H20N2S — CID 58855700
(3aS,6aR)-2-methylidene-4-pentyl-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazole (PubChem CID 58855700) has the molecular formula C11H20N2S and a molecular weight of 212.36 g/mol. Its IUPAC name is (3aS,6aR)-2-methylidene-4-pentyl-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazole.
| Compound Name | (3aS,6aR)-2-methylidene-4-pentyl-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazole |
|---|---|
| PubChem CID | 58855700 |
| Molecular Formula | C11H20N2S |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | (3aS,6aR)-2-methylidene-4-pentyl-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazole |
| SMILES | C=C1N[C@H]2CSC(CCCCC)[C@H]2N1 |
| InChI | InChI=1S/C11H20N2S/c1-3-4-5-6-10-11-9(7-14-10)12-8(2)13-11/h9-13H,2-7H2,1H3/t9-,10?,11-/m0/s1 |
| InChIKey | QSENPRIODWTODD-JRUYECLLSA-N |
| XLogP | 2.08 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|