C7H12N2S — CID 58855726
(3aS,6aR)-4-methyl-2-methylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazole (PubChem CID 58855726) has the molecular formula C7H12N2S and a molecular weight of 156.25 g/mol. Its IUPAC name is (3aS,6aR)-4-methyl-2-methylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazole.
| Compound Name | (3aS,6aR)-4-methyl-2-methylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazole |
|---|---|
| PubChem CID | 58855726 |
| Molecular Formula | C7H12N2S |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | (3aS,6aR)-4-methyl-2-methylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazole |
| SMILES | C=C1N[C@H]2CSC(C)[C@H]2N1 |
| InChI | InChI=1S/C7H12N2S/c1-4-7-6(3-10-4)8-5(2)9-7/h4,6-9H,2-3H2,1H3/t4?,6-,7+/m0/s1 |
| InChIKey | QEQUKYJOBPBLFJ-RUJZHYJYSA-N |
| XLogP | 0.52 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |