C27H45O4P — CID 58855784
(5S,10S,13R,17R)-17-[(E,2S)-4-diethoxyphosphorylbut-3-en-2-yl]-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 58855784) has the molecular formula C27H45O4P and a molecular weight of 464.63 g/mol. Its IUPAC name is (5S,10S,13R,17R)-17-[(E,2S)-4-diethoxyphosphorylbut-3-en-2-yl]-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (5S,10S,13R,17R)-17-[(E,2S)-4-diethoxyphosphorylbut-3-en-2-yl]-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 58855784 |
| Molecular Formula | C27H45O4P |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.31 |
| IUPAC Name | (5S,10S,13R,17R)-17-[(E,2S)-4-diethoxyphosphorylbut-3-en-2-yl]-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CCOP(=O)(/C=C/[C@@H](C)[C@H]1CCC2C3CC[C@H]4CC(=O)CC[C@]4(C)C3CC[C@@]21C)OCC |
| InChI | InChI=1S/C27H45O4P/c1-6-30-32(29,31-7-2)17-14-19(3)23-10-11-24-22-9-8-20-18-21(28)12-15-26(20,4)25(22)13-16-27(23,24)5/h14,17,19-20,22-25H,6-13,15-16,18H2,1-5H3/b17-14+/t19-,20+,22?,23-,24?,25?,26+,27-/m1/s1 |
| InChIKey | BHHLAXNYXRJYEB-JECVVRCMSA-N |
| XLogP | 7.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|