C22H18ClN3O5S — CID 58856179
4-(3-chloro-5-cyanophenoxy)-3-methoxy-N-(2-methyl-4-sulfamoylphenyl)benzamide (PubChem CID 58856179) has the molecular formula C22H18ClN3O5S and a molecular weight of 471.92 g/mol. Its IUPAC name is 4-(3-chloro-5-cyanophenoxy)-3-methoxy-N-(2-methyl-4-sulfamoylphenyl)benzamide.
| Compound Name | 4-(3-chloro-5-cyanophenoxy)-3-methoxy-N-(2-methyl-4-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 58856179 |
| Molecular Formula | C22H18ClN3O5S |
| Molecular Weight | 471.92 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | 4-(3-chloro-5-cyanophenoxy)-3-methoxy-N-(2-methyl-4-sulfamoylphenyl)benzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(S(N)(=O)=O)cc2C)ccc1Oc1cc(Cl)cc(C#N)c1 |
| InChI | InChI=1S/C22H18ClN3O5S/c1-13-7-18(32(25,28)29)4-5-19(13)26-22(27)15-3-6-20(21(10-15)30-2)31-17-9-14(12-24)8-16(23)11-17/h3-11H,1-2H3,(H,26,27)(H2,25,28,29) |
| InChIKey | HTWJGGODAUPZQP-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 131.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.92 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |