About 2-methyl-N'-propan-2-yl-3a,7a-dihydro-3H-benzimidazole-5-carboximidamide
2-methyl-N'-propan-2-yl-3a,7a-dihydro-3H-benzimidazole-5-carboximidamide (PubChem CID 58856209) has the molecular formula C12H18N4
and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-methyl-N'-propan-2-yl-3a,7a-dihydro-3H-benzimidazole-5-carboximidamide.
Molecular Properties
| Compound Name | 2-methyl-N'-propan-2-yl-3a,7a-dihydro-3H-benzimidazole-5-carboximidamide |
| PubChem CID | 58856209 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 2-methyl-N'-propan-2-yl-3a,7a-dihydro-3H-benzimidazole-5-carboximidamide |
| SMILES | CC1=NC2C=CC(/C(N)=N/C(C)C)=CC2N1 |
| InChI | InChI=1S/C12H18N4/c1-7(2)14-12(13)9-4-5-10-11(6-9)16-8(3)15-10/h4-7,10-11H,1-3H3,(H2,13,14)(H,15,16) |
| InChIKey | LIRQVSILXOBWOB-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N'-propan-2-yl-3a,7a-dihydro-3H-benzimidazole-5-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N'-propan-2-yl-3a,7a-dihydro-3H-benzimidazole-5-carboximidamide?
The IUPAC name of 2-methyl-N'-propan-2-yl-3a,7a-dihydro-3H-benzimidazole-5-carboximidamide (CID 58856209) is 2-methyl-N'-propan-2-yl-3a,7a-dihydro-3H-benzimidazole-5-carboximidamide.
What is the SMILES notation for 2-methyl-N'-propan-2-yl-3a,7a-dihydro-3H-benzimidazole-5-carboximidamide?
The canonical SMILES for 2-methyl-N'-propan-2-yl-3a,7a-dihydro-3H-benzimidazole-5-carboximidamide is CC1=NC2C=CC(/C(N)=N/C(C)C)=CC2N1.
What is the InChIKey of 2-methyl-N'-propan-2-yl-3a,7a-dihydro-3H-benzimidazole-5-carboximidamide?
The InChIKey is LIRQVSILXOBWOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4/c1-7(2)14-12(13)9-4-5-10-11(6-9)16-8(3)15-10/h4-7,10-11H,1-3H3,(H2,13,14)(H,15,16).
What are the key properties of 2-methyl-N'-propan-2-yl-3a,7a-dihydro-3H-benzimidazole-5-carboximidamide?
2-methyl-N'-propan-2-yl-3a,7a-dihydro-3H-benzimidazole-5-carboximidamide has a molecular weight of 218.30 g/mol, XLogP of 1.01, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N'-propan-2-yl-3a,7a-dihydro-3H-benzimidazole-5-carboximidamide is sourced from PubChem (CID 58856209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).