About [3-deuterio-1-[(1R,2R)-2-hydroxycyclohexyl]-2,5-dioxopyrrolidin-3-yl] acetate
[3-deuterio-1-[(1R,2R)-2-hydroxycyclohexyl]-2,5-dioxopyrrolidin-3-yl] acetate (PubChem CID 58856253) has the molecular formula C12H17NO5
and a molecular weight of 256.28 g/mol. Its IUPAC name is [3-deuterio-1-[(1R,2R)-2-hydroxycyclohexyl]-2,5-dioxopyrrolidin-3-yl] acetate.
Molecular Properties
| Compound Name | [3-deuterio-1-[(1R,2R)-2-hydroxycyclohexyl]-2,5-dioxopyrrolidin-3-yl] acetate |
| PubChem CID | 58856253 |
| Molecular Formula | C12H17NO5 |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | [3-deuterio-1-[(1R,2R)-2-hydroxycyclohexyl]-2,5-dioxopyrrolidin-3-yl] acetate |
| SMILES | [2H]C1(OC(C)=O)CC(=O)N([C@@H]2CCCC[C@H]2O)C1=O |
| InChI | InChI=1S/C12H17NO5/c1-7(14)18-10-6-11(16)13(12(10)17)8-4-2-3-5-9(8)15/h8-10,15H,2-6H2,1H3/t8-,9-,10?/m1/s1/i10D |
| InChIKey | HYGKAXSRCDSUKO-JVAPGIPWSA-N |
| XLogP | -0.02 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [3-deuterio-1-[(1R,2R)-2-hydroxycyclohexyl]-2,5-dioxopyrrolidin-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-deuterio-1-[(1R,2R)-2-hydroxycyclohexyl]-2,5-dioxopyrrolidin-3-yl] acetate?
The IUPAC name of [3-deuterio-1-[(1R,2R)-2-hydroxycyclohexyl]-2,5-dioxopyrrolidin-3-yl] acetate (CID 58856253) is [3-deuterio-1-[(1R,2R)-2-hydroxycyclohexyl]-2,5-dioxopyrrolidin-3-yl] acetate.
What is the SMILES notation for [3-deuterio-1-[(1R,2R)-2-hydroxycyclohexyl]-2,5-dioxopyrrolidin-3-yl] acetate?
The canonical SMILES for [3-deuterio-1-[(1R,2R)-2-hydroxycyclohexyl]-2,5-dioxopyrrolidin-3-yl] acetate is [2H]C1(OC(C)=O)CC(=O)N([C@@H]2CCCC[C@H]2O)C1=O.
What is the InChIKey of [3-deuterio-1-[(1R,2R)-2-hydroxycyclohexyl]-2,5-dioxopyrrolidin-3-yl] acetate?
The InChIKey is HYGKAXSRCDSUKO-JVAPGIPWSA-N. The full InChI is InChI=1S/C12H17NO5/c1-7(14)18-10-6-11(16)13(12(10)17)8-4-2-3-5-9(8)15/h8-10,15H,2-6H2,1H3/t8-,9-,10?/m1/s1/i10D.
What are the key properties of [3-deuterio-1-[(1R,2R)-2-hydroxycyclohexyl]-2,5-dioxopyrrolidin-3-yl] acetate?
[3-deuterio-1-[(1R,2R)-2-hydroxycyclohexyl]-2,5-dioxopyrrolidin-3-yl] acetate has a molecular weight of 256.28 g/mol, XLogP of -0.02, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-deuterio-1-[(1R,2R)-2-hydroxycyclohexyl]-2,5-dioxopyrrolidin-3-yl] acetate is sourced from PubChem (CID 58856253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).