About 2-cyclohexylethyl 3,5-bis(2-cyclohexylethylperoxymethyl)-4-(trioxidanylsulfanyl)benzoate
2-cyclohexylethyl 3,5-bis(2-cyclohexylethylperoxymethyl)-4-(trioxidanylsulfanyl)benzoate (PubChem CID 58856288) has the molecular formula C33H52O9S
and a molecular weight of 624.84 g/mol. Its IUPAC name is 2-cyclohexylethyl 3,5-bis(2-cyclohexylethylperoxymethyl)-4-(trioxidanylsulfanyl)benzoate.
Molecular Properties
| Compound Name | 2-cyclohexylethyl 3,5-bis(2-cyclohexylethylperoxymethyl)-4-(trioxidanylsulfanyl)benzoate |
| PubChem CID | 58856288 |
| Molecular Formula | C33H52O9S |
| Molecular Weight | 624.84 g/mol |
| Exact Mass | 624.33 |
| IUPAC Name | 2-cyclohexylethyl 3,5-bis(2-cyclohexylethylperoxymethyl)-4-(trioxidanylsulfanyl)benzoate |
| SMILES | O=C(OCCC1CCCCC1)c1cc(COOCCC2CCCCC2)c(SOOO)c(COOCCC2CCCCC2)c1 |
| InChI | InChI=1S/C33H52O9S/c34-33(36-19-16-26-10-4-1-5-11-26)29-22-30(24-39-37-20-17-27-12-6-2-7-13-27)32(43-42-41-35)31(23-29)25-40-38-21-18-28-14-8-3-9-15-28/h22-23,26-28,35H,1-21,24-25H2 |
| InChIKey | OOFYVLJSFPPXAW-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 624.84 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexylethyl 3,5-bis(2-cyclohexylethylperoxymethyl)-4-(trioxidanylsulfanyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexylethyl 3,5-bis(2-cyclohexylethylperoxymethyl)-4-(trioxidanylsulfanyl)benzoate?
The IUPAC name of 2-cyclohexylethyl 3,5-bis(2-cyclohexylethylperoxymethyl)-4-(trioxidanylsulfanyl)benzoate (CID 58856288) is 2-cyclohexylethyl 3,5-bis(2-cyclohexylethylperoxymethyl)-4-(trioxidanylsulfanyl)benzoate.
What is the SMILES notation for 2-cyclohexylethyl 3,5-bis(2-cyclohexylethylperoxymethyl)-4-(trioxidanylsulfanyl)benzoate?
The canonical SMILES for 2-cyclohexylethyl 3,5-bis(2-cyclohexylethylperoxymethyl)-4-(trioxidanylsulfanyl)benzoate is O=C(OCCC1CCCCC1)c1cc(COOCCC2CCCCC2)c(SOOO)c(COOCCC2CCCCC2)c1.
What is the InChIKey of 2-cyclohexylethyl 3,5-bis(2-cyclohexylethylperoxymethyl)-4-(trioxidanylsulfanyl)benzoate?
The InChIKey is OOFYVLJSFPPXAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H52O9S/c34-33(36-19-16-26-10-4-1-5-11-26)29-22-30(24-39-37-20-17-27-12-6-2-7-13-27)32(43-42-41-35)31(23-29)25-40-38-21-18-28-14-8-3-9-15-28/h22-23,26-28,35H,1-21,24-25H2.
What are the key properties of 2-cyclohexylethyl 3,5-bis(2-cyclohexylethylperoxymethyl)-4-(trioxidanylsulfanyl)benzoate?
2-cyclohexylethyl 3,5-bis(2-cyclohexylethylperoxymethyl)-4-(trioxidanylsulfanyl)benzoate has a molecular weight of 624.84 g/mol, XLogP of 9.08, 19 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexylethyl 3,5-bis(2-cyclohexylethylperoxymethyl)-4-(trioxidanylsulfanyl)benzoate is sourced from PubChem (CID 58856288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).